Home
Products
Propyl gallate
| Product Name | Propyl gallate |
| Price: | $18 / 20mg |
| Catalog No.: | CN03454 |
| CAS No.: | 121-79-9 |
| Molecular Formula: | C10H12O5 |
| Molecular Weight: | 212.20 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | From Rhus chinensis Mill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCOC(=O)c1cc(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Propyl gallate is a common food antioxidant. Propyl gallate can inhibit the production of acrolein, glyoxal and methylglyoxal[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 448.6±40.0 °C at 760 mmHg |
| Flash Point | 181.3±20.8 °C |
| Exact Mass | 212.068466 |
| PSA | 86.99000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 0-6°C |