Home
Products
Lophanthoidin F
| Product Name | Lophanthoidin F |
| Price: | Inquiry |
| Catalog No.: | CN08942 |
| CAS No.: | 120462-46-6 |
| Molecular Formula: | C24H34O7 |
| Molecular Weight: | 434.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Rabdosia lophanthoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC1C2=C(C(=O)C(=O)C(=C2O)C(COC(=O)C)C)C2(C(C1O)C(C)(C)CCC2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lophanthoidin F is a diterpenoids compound isolated from the dried leaves of Rabdosia lophanthoides[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 562.6±50.0 °C at 760 mmHg |
| Flash Point | 185.2±23.6 °C |
| Exact Mass | 434.230438 |
| PSA | 110.13000 |
| LogP | 5.16 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |