Home
Products
Lophanthoidin E
| Product Name | Lophanthoidin E |
| Price: | Inquiry |
| Catalog No.: | CN08943 |
| CAS No.: | 120462-45-5 |
| Molecular Formula: | C22H30O7 |
| Molecular Weight: | 406.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Rabdosia lophanthoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC(C1=C(O)C2=C(C(=O)C1=O)C1(C)CCCC(C1C(C2O)O)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lophanthoidin E is a diterpenoids compound isolated from the dried leaves of Rabdosia lophanthoides[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 551.3±50.0 °C at 760 mmHg |
| Flash Point | 186.4±23.6 °C |
| Exact Mass | 406.199158 |
| PSA | 121.13000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |