Home
Products
Desoxyanisoin
| Product Name | Desoxyanisoin |
| Price: | Inquiry |
| Catalog No.: | CN04000 |
| CAS No.: | 120-44-5 |
| Molecular Formula: | C16H16O3 |
| Molecular Weight: | 256.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Cryst. |
| Source: | The fruits of Foeniculum vulgare |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)CC(=O)c1ccc(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 415.6±25.0 °C at 760 mmHg |
| Flash Point | 196.9±9.6 °C |
| Exact Mass | 256.109955 |
| PSA | 35.53000 |
| LogP | 3.17 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |