Home
Products
Tropine
| Product Name | Tropine |
| Price: | $15 / 50mg |
| Catalog No.: | CN01706 |
| CAS No.: | 120-29-6 |
| Molecular Formula: | C8H15NO |
| Molecular Weight: | 141.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Atropa belladonna |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@@H]2CC[C@H](C1)N2C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tropine is a secondary metabolite of Solanaceae plants, is an anticholinergic agent[1]. Tropine is a common intermediate in the synthesis of a variety of bioactive alkaloids, including hyoscyamine and scopolamine[2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 233.0±0.0 °C at 760 mmHg |
| Flash Point | 112.5±14.5 °C |
| Exact Mass | 141.115356 |
| PSA | 23.47000 |
| LogP | -0.10 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Storage condition | 2-8°C |