Home
Products
Coptisine sulfate
| Product Name | Coptisine sulfate |
| Price: | $143 / 10mg |
| Catalog No.: | CN01425 |
| CAS No.: | 1198398-71-8 |
| Molecular Formula: | C19H15NO8S |
| Molecular Weight: | 417.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Chelidonium majus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C1Oc2c(O1)cc1c(c2)CC[n+]2c1cc1ccc3c(c1c2)OCO3.[O-]OS(=O)=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Coptisine Sulfate is an alkaloid from Chinese goldthread, and acts as an efficient uncompetitive IDO inhibitor with a Ki value of 5.8 μM and an IC50 value of 6.3 μM[1]. |
| Target | IC50: 6.3 μM (IDO)[1] Ki: 5.8 μM (IDO)[1] |
| Exact Mass | 417.051849 |