Home
Products
Tranexamic acid
| Product Name | Tranexamic acid |
| Price: | Inquiry |
| Catalog No.: | CN01122 |
| CAS No.: | 1197-18-8 |
| Molecular Formula: | C8H15NO2 |
| Molecular Weight: | 157.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | NC[C@@H]1CC[C@H](CC1)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tranexamic acid (Transamin) is an antifibrinolytic for blocking lysine-binding sites of plasmin and elastase-derived plasminogen fragments with IC50 of 5 mM. Target: OthersTranexamic acid is a synthetic derivative of the amino acid lysine. Tranexamic acid is frequently used in surgeries with high risk of blood loss such as cardiac, liver, vascular and large orthopedic procedures. Its oral form is now being evaluated for use in outpatient conditions involving heavy bleeding.Toxicity/Adverse event: Rare in general, including gastrointestinal effects, dizziness, fatigue, headache, and hypersensitivity reactions. Use of tranexamic acid has a potential risk of thrombosis. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 300.2±15.0 °C at 760 mmHg |
| Flash Point | 135.4±20.4 °C |
| Exact Mass | 157.110275 |
| PSA | 63.32000 |
| LogP | 0.31 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |