Home
Products
(-)-Verbenone
| Product Name | (-)-Verbenone |
| Price: | Inquiry |
| Catalog No.: | CN09612 |
| CAS No.: | 1196-01-6 |
| Molecular Formula: | C10H14O |
| Molecular Weight: | 150.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The essential oil of Rosmarinus officinalis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=CC(=O)[C@H]2C[C@@H]1C2(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Verbenone ((-)-Verbenone) is a natural terpene in leaves of the tree, Suregada zanzibariensis Verdc[1]. Verbenone has anti-aggregation pheromone and interrupts the attraction of bark beetles to their aggregation pheromones[2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 227.5±0.0 °C at 760 mmHg |
| Flash Point | 85.0±0.0 °C |
| Exact Mass | 150.104462 |
| PSA | 17.07000 |
| LogP | 1.97 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Storage condition | 2-8°C |