Home
Products
Licoricesaponin E2
| Product Name | Licoricesaponin E2 |
| Price: | Inquiry |
| Catalog No.: | CN07368 |
| CAS No.: | 119417-96-8 |
| Molecular Formula: | C42H60O16 |
| Molecular Weight: | 820.92 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C1C=C2[C@@H]3C[C@]4(C)C[C@H]([C@]3(C)CC[C@]2([C@]2([C@H]1[C@@]1(C)CC[C@@H](C([C@@H]1CC2)(C)C)O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O)O)O)C)C)OC4=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoricesaponin E2 (compound 5) is a triterpene saponinthat can be found in Glycyrrhiza inflata[1]. |
| Exact Mass | 820.38800 |
| PSA | 256.04000 |
| LogP | 1.69630 |