Home
Products
Scutellarin methylester
| Product Name | Scutellarin methylester |
| Price: | $277 / 10mg |
| Catalog No.: | CN04891 |
| CAS No.: | 119262-68-9 |
| Molecular Formula: | C22H20O12 |
| Molecular Weight: | 476.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Scutellaria baicalensis Georgi |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COC(=O)[C@H]1O[C@@H](Oc2cc3oc(cc(=O)c3c(c2O)O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scutellarin methyl ester is a constituent of Breviscapine which is a crude extract of several flavonoids of Erigeron breviscapus[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 804.0±65.0 °C at 760 mmHg |
| Flash Point | 281.5±27.8 °C |
| Exact Mass | 476.095490 |
| PSA | 196.35000 |
| LogP | 0.12 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |