Home
Products
(+)-Delta-Tocopherol
| Product Name | (+)-Delta-Tocopherol |
| Price: | Inquiry |
| Catalog No.: | CN03403 |
| CAS No.: | 119-13-1 |
| Molecular Formula: | C27H46O2 |
| Molecular Weight: | 402.7 g/mol |
| Purity: | >95% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The roots of Stemona sessilifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCCC1(C)CCc2c(O1)c(C)cc(c2)O)CCCC(CCCC(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Delta-Tocopherol is an isomer of Vitamin E. |
| Target | Human Endogenous Metabolite |
| Density | 0.935 g/cm3 |
| Boiling Point | 504.3ºC at 760 mmHg |
| Flash Point | 200.1ºC |
| Exact Mass | 402.35000 |
| PSA | 29.46000 |
| LogP | 8.22340 |
| Vapour Pressure | 8.54E-11mmHg at 25°C |
| Storage condition | 2~8°C |