Home
Products
Baohuoside V
| Product Name | Baohuoside V |
| Price: | $351 / 5mg |
| Catalog No.: | CN04857 |
| CAS No.: | 118544-18-6 |
| Molecular Formula: | C38H48O19 |
| Molecular Weight: | 808.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Epimedium brevicornum Maxim |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(O)c3c(c2CC=C(C)C)oc(c(c3=O)OC2OC(C)C(C(C2OC2OC(C)C(C(C2O)O)O)O)O)c2ccc(cc2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Baohuoside V is a flavonoid isolated from the dried herb of Epimedium davidii[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1082.7±65.0 °C at 760 mmHg |
| Flash Point | 330.9±27.8 °C |
| Exact Mass | 808.278992 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |