Home
Products
Licoricesaponin H2
| Product Name | Licoricesaponin H2 |
| Price: | $161 / 5mg |
| Catalog No.: | CN07212 |
| CAS No.: | 118441-85-3 |
| Molecular Formula: | C42H62O16 |
| Molecular Weight: | 822.92 g/mol |
| Purity: | >95% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza glabra L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O[C@@H]2O[C@H](C(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@@H](O[C@@H]([C@H]1O)C(=O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@@](C)(CC1)C(=O)O)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licorice-saponin H2 ((18β,20α)-Glycyrrhizic acid) is a saponin from Glycyrrhiza uralensis Fischer[1]. |
| Density | 1.43±0.1 g/cm3(Predicted) |
| Boiling Point | 971.4±65.0 °C(Predicted) |