Home
Products
Licoricesaponin G2
| Product Name | Licoricesaponin G2 |
| Price: | Inquiry |
| Catalog No.: | CN07365 |
| CAS No.: | 118441-84-2 |
| Molecular Formula: | C42H62O17 |
| Molecular Weight: | 838.93 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza uralensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@@]1(C)[C@H](CC[C@]2([C@H]1CC[C@@]1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@@](CC1)(C)C(=O)O)C)C)C)O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoricesaponin G2 is a pentacyclic triterpenoid isolated from Glycyrrhiza aspera[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 1005.2±65.0 °C at 760 mmHg |
| Flash Point | 298.3±27.8 °C |
| Exact Mass | 838.398682 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |