Home
Products
1,4-Dicaffeoylquinic acid
| Product Name | 1,4-Dicaffeoylquinic acid |
| Price: | $409 / 5mg |
| Catalog No.: | CN07035 |
| CAS No.: | 1182-34-9 |
| Molecular Formula: | C25H24O12 |
| Molecular Weight: | 516.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White powder |
| Source: | The flowerbud of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CO[C@]1(CC[C@H]([C@H]([C@@H]1O)O)OC(=O)/C=C/c1ccc(c(c1)O)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,4-Dicaffeoylquinic acid (1,4-DCQA) is a phenylpropanoid from Xanthii fructus, inhibits LPS-stimulated TNF-α production[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 819.9±65.0 °C at 760 mmHg |
| Flash Point | 278.1±27.8 °C |
| Exact Mass | 516.126770 |
| PSA | 211.28000 |
| LogP | 1.99 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |