Home
Products
Blumeatin
| Product Name | Blumeatin |
| Price: | $234 / 10mg |
| Catalog No.: | CN05567 |
| CAS No.: | 118024-26-3 |
| Molecular Formula: | C16H14O6 |
| Molecular Weight: | 302.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Blumea balsamifera |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@@H](CC(=O)c2c(c1)O)c1cc(O)cc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Blumeatin, isolated from Blumea balsamifera DC, could protect liver against injury induced by CCl4 and thioacetamide (TAA)[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 603.3±55.0 °C at 760 mmHg |
| Flash Point | 229.7±25.0 °C |
| Exact Mass | 302.079041 |
| PSA | 96.22000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |