Home
Products
Syringin
| Product Name | Syringin |
| Price: | $46 / 20mg |
| Catalog No.: | CN07048 |
| CAS No.: | 118-34-3 |
| Molecular Formula: | C17H24O9 |
| Molecular Weight: | 372.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Syringa vulgaris |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC/C=C/c1cc(OC)c(c(c1)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Syringin is a main bioactive phenolic glycoside in Acanthopanax senticosus, with anti-osteoporosis activity. Syringin prevents cardiac hypertrophy induced by pressure overload through the attenuation of autophagy[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 642.6±55.0 °C at 760 mmHg |
| Flash Point | 342.4±31.5 °C |
| Exact Mass | 372.142029 |
| PSA | 138.07000 |
| LogP | -1.94 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Storage condition | 2-8°C |