Home
Products
Cinchonine
| Product Name | Cinchonine |
| Price: | $18 / 20mg |
| Catalog No.: | CN01337 |
| CAS No.: | 118-10-5 |
| Molecular Formula: | C19H22N2O |
| Molecular Weight: | 294.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The barks of Cinchona ledgeriana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](c1ccnc2c1cccc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cinchonine is a natural compound present in Cinchona bark. Cinchonine activates endoplasmic reticulum stress-induced apoptosis in human liver cancer cells[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 464.5±30.0 °C at 760 mmHg |
| Flash Point | 234.7±24.6 °C |
| Exact Mass | 294.173218 |
| PSA | 36.36000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |