Home
Products
Guanosine
| Product Name | Guanosine |
| Price: | $18 / 20mg |
| Catalog No.: | CN01028 |
| CAS No.: | 118-00-3 |
| Molecular Formula: | C10H13N5O5 |
| Molecular Weight: | 283.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(N)[nH]c2=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Guanosine is a purine nucleoside comprising guanine attached to a ribose (ribofuranose) ring via a β-N9-glycosidic bond. |
| Target | Human Endogenous Metabolite |
| In Vitro | Guanosine can be phosphorylated to become guanosine monophosphate (GMP), cyclic guanosine monophosphate (cGMP), guanosine diphosphate (GDP), and guanosine triphosphate (GTP). These forms play important roles in various biochemical processes such as synthesis of nucleic acids and proteins, photosynthesis, muscle contraction, and intracellular signal transduction (cGMP). |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 756.6±70.0 °C at 760 mmHg |
| Flash Point | 411.4±35.7 °C |
| Exact Mass | 283.091675 |
| PSA | 159.51000 |
| LogP | -3.27 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Storage condition | 2~8°C |