Home
Products
Sesamoside
| Product Name | Sesamoside |
| Price: | $92 / 20mg |
| Catalog No.: | CN03197 |
| CAS No.: | 117479-87-5 |
| Molecular Formula: | C17H24O12 |
| Molecular Weight: | 420.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Sesamum angolense. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@]3([C@H]2[C@@]2(C)O[C@H]2[C@H]3O)O)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sesamoside is a iridoid isolated from the aerial part of Phlomis linearifolia. Sesamoside has antiodant and antiglycation activities[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 677.9±55.0 °C at 760 mmHg |
| Flash Point | 244.2±25.0 °C |
| Exact Mass | 420.126770 |
| PSA | 187.90000 |
| LogP | -2.26 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Storage condition | 2-8°C |