Home
Products
Soyasaponin Be
| Product Name | Soyasaponin Be |
| Price: | Inquiry |
| Catalog No.: | CN07538 |
| CAS No.: | 117210-14-7 |
| Molecular Formula: | C48H76O18 |
| Molecular Weight: | 941.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2=O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydrosoyasaponin I (Soyasaponin Be;DHS-I), a triterpene glycoside, is a potent and reversible calcium-activated potassium (maxi-K) channels activator[1]. |
| Exact Mass | 940.50300 |
| PSA | 291.82000 |
| LogP | 0.91280 |
| Vapour Pressure | 0mmHg at 25°C |