Home
Products
3'-Hydroxypuerarin
| Product Name | 3'-Hydroxypuerarin |
| Price: | $92 / 20mg |
| Catalog No.: | CN04896 |
| CAS No.: | 117060-54-5 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)O)c1c(O)ccc2c1occ(c2=O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3'-Hydroxypuerarin is an isoflavone isolated from the roots of Pueraria lobata (Willd.) Ohwi. 3'-Hydroxypuerarin is a antioxidant, which shows marked ONOO(-), NO•, total ROS scavenging activities[1][2][3]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 734.5±60.0 °C at 760 mmHg |
| Flash Point | 261.1±26.4 °C |
| Exact Mass | 432.105652 |
| PSA | 181.05000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |