Home
Products
Bis(2-ethylhexyl) phthalate
| Product Name | Bis(2-ethylhexyl) phthalate |
| Price: | Inquiry |
| Catalog No.: | CN06739 |
| CAS No.: | 117-81-7 |
| Molecular Formula: | C24H38O4 |
| Molecular Weight: | 390.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The heartwood of Pterocarpus angolensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCC(COC(=O)c1ccccc1C(=O)OCC(CCCC)CC)CC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 384.9±10.0 °C at 760 mmHg |
| Flash Point | 207.2±0.0 °C |
| Exact Mass | 390.277008 |
| PSA | 52.60000 |
| LogP | 8.71 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |