Home
Products
2-Anthraquinonecarboxylic acid
| Product Name | 2-Anthraquinonecarboxylic acid |
| Price: | Inquiry |
| Catalog No.: | CN05966 |
| CAS No.: | 117-78-2 |
| Molecular Formula: | C15H8O4 |
| Molecular Weight: | 252.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Rubia cordifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1c2cc(ccc2C(=O)c2c1cccc2)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Anthraquinone-2-carboxylic acid is a major anthraquinone isolated from Brazilian taheebo, with anti-inflammatory activity and antinociceptive[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 518.3±39.0 °C at 760 mmHg |
| Flash Point | 281.3±23.6 °C |
| Exact Mass | 252.042252 |
| PSA | 71.44000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |