Home
Products
Rubiadin
| Product Name | Rubiadin |
| Price: | $117 / 10mg |
| Catalog No.: | CN06008 |
| CAS No.: | 117-02-2 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Rubia cordifolia. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1c2ccccc2C(=O)c2c1c(O)c(c(c2)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rubiadin is a dihydroxy anthraquinone isolated from Rubia cordifolia. Rubiadin has a potent antixidant activity[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 527.1±30.0 °C at 760 mmHg |
| Flash Point | 286.6±21.1 °C |
| Exact Mass | 254.057907 |
| PSA | 74.60000 |
| LogP | 4.44 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |