Home
Products
Sculponeatin N
| Product Name | Sculponeatin N |
| Price: | Inquiry |
| Catalog No.: | CN08958 |
| CAS No.: | 1169805-98-4 |
| Molecular Formula: | C25H40O4 |
| Molecular Weight: | 404.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rabdosia amethystoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CC(=O)OCC1(O)CC23CC1CCC3C1(C(CC2O)C(C)(C)CCC1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sculponeatin N is a ent-kaurane diterpene derivative compound isolated from the plant Isodon sculponeata[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 515.0±25.0 °C at 760 mmHg |
| Flash Point | 166.1±16.7 °C |
| Exact Mass | 404.292664 |
| PSA | 66.76000 |
| LogP | 6.22 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |