Home
Products
4',5,6,7-Tetramethoxyflavone
| Product Name | 4',5,6,7-Tetramethoxyflavone |
| Price: | $394 / 10mg |
| Catalog No.: | CN04538 |
| CAS No.: | 1168-42-9 |
| Molecular Formula: | C19H18O6 |
| Molecular Weight: | 342.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scutellaria baicalensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(c(c2OC)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Scutellarein tetramethyl ether (4',5,6,7-Tetramethoxyflavone) is a bioactive component of Siam weed extract. Scutellarein tetramethyl ether (4',5,6,7-Tetramethoxyflavone) exhibits anti-inflammatory activity through NF-κB pathway[1]. Scutellarein tetramethyl ether (4',5,6,7-Tetramethoxyflavone) modulats of bacterial drug resistance via efflux pump inhibition[2]. Scutellarein tetramethyl ether (4',5,6,7-Tetramethoxyflavone) can enhance blood coagulation[3]. |
| Density | 1.243g/cm3 |
| Boiling Point | 525.7ºC at 760mmHg |
| Flash Point | 232.4ºC |
| Exact Mass | 342.11000 |
| PSA | 67.13000 |
| LogP | 3.49440 |
| Vapour Pressure | 3.84E-11mmHg at 25°C |