Home
Products
9'-Methyl lithospermate B
| Product Name | 9'-Methyl lithospermate B |
| Price: | $234 / 10mg |
| Catalog No.: | CN06866 |
| CAS No.: | 1167424-31-8 |
| Molecular Formula: | C37H32O16 |
| Molecular Weight: | 732.64 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COC(=O)C(Cc1ccc(c(c1)O)O)OC(=O)C=Cc1ccc(c2c1C(C(=O)OC(C(=O)O)Cc1ccc(c(c1)O)O)C(O2)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 9''-Methyl salvianolate B is a phenolic compound isolated from Radix Salvia miltiorrhizae[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 992.9±65.0 °C at 760 mmHg |
| Flash Point | 310.9±27.8 °C |
| Exact Mass | 732.169006 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |