Home
Products
Aflatoxin G1
| Product Name | Aflatoxin G1 |
| Price: | Inquiry |
| Catalog No.: | CN03443 |
| CAS No.: | 1165-39-5 |
| Molecular Formula: | C17H12O7 |
| Molecular Weight: | 328.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | From Aspergillus flavus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@H]3[C@@H](c2c2c1c1CCOC(=O)c1c(=O)o2)C=CO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aflatoxin G1 is one type of aflatoxins occuring in nature. It is produced by molds, such as Aspergillus flavus and Aspergillus parasiticus. Aflatoxins are hepatogenic, teratogenic, imunosuppressive, and carcinogenic fungal metabolites found in feeds, nuts, wine-grapes, spices, and other grain crops[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 612.1±55.0 °C at 760 mmHg |
| Flash Point | 274.1±31.5 °C |
| Exact Mass | 328.058289 |
| PSA | 84.20000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |