Home
Products
Salvianolic acid B
| Product Name | Salvianolic acid B |
| Price: | $46 / 20mg |
| Catalog No.: | CN07046 |
| CAS No.: | 115939-25-8 |
| Molecular Formula: | C36H30O16 |
| Molecular Weight: | 718.62 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H](C(=O)O)Cc1ccc(c(c1)O)O)/C=C/c1ccc(c2c1[C@H](C(=O)O[C@@H](C(=O)O)Cc1ccc(c(c1)O)O)[C@H](O2)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1020.3±65.0 °C at 760 mmHg |
| Flash Point | 322.1±27.8 °C |
| Exact Mass | 718.153381 |
| PSA | 278.04000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |