Home
Products
Angoroside C
| Product Name | Angoroside C |
| Price: | $77 / 20mg |
| Catalog No.: | CN06988 |
| CAS No.: | 115909-22-3 |
| Molecular Formula: | C36H48O19 |
| Molecular Weight: | 784.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White powder |
| Source: | The roots of Scrophularia ningpoensis Hemsl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1O)CCO[C@@H]1O[C@H](CO[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)OC(=O)/C=C/c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Angoroside C, a phenylpropanoid glycoside isolated from Radix Scrophulariae, has beneficial effects against ventricular remodeling[1]. |
| In Vivo | Angoroside C has beneficial effects against ventricular remodeling. The mechanism is likely to be related to decreasing the level of Ang Ⅱ, attenuating the mRNA expressions of ET-1 and TGF-β1[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 985.7±65.0 °C at 760 mmHg |
| Flash Point | 301.7±27.8 °C |
| Exact Mass | 784.278992 |
| PSA | 282.21000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |