Home
Products
Tubeimoside III
| Product Name | Tubeimoside III |
| Price: | $92 / 10mg |
| Catalog No.: | CN07507 |
| CAS No.: | 115810-13-4 |
| Molecular Formula: | C64H100O31 |
| Molecular Weight: | 1365.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Bolbostemma paniculatum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC2OC3C(O)CC4(C(C3(C)CO)CCC3(C4CC=C4C3(C)CC(C3(C4CC(C)(C)CC3)C(=O)OC3OCC(C(C3OC3OC(C(OC(=O)CC(CC(=O)OCC4OC(OC2C(C1O)O)C(O)C(C4O)O)(C)O)C(OC1OCC(C(C1O)O)O)C3O)C)O)O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tubeimoside III, a triterpenoid saponin isolated from a Chinese folk medicine"Tubeimu", shows anti-inflammatory, anti-tumor, anti-tumorigenic activities, and acute toxicity in vivo[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1364.624878 |
| PSA | 485.65000 |
| LogP | 3.82 |
| Storage condition | 2-8℃ |