Home
Products
Daidzein dimethyl ether
| Product Name | Daidzein dimethyl ether |
| Price: | $103 / 20mg |
| Catalog No.: | CN04754 |
| CAS No.: | 1157-39-7 |
| Molecular Formula: | C17H14O4 |
| Molecular Weight: | 282.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1coc2c(c1=O)ccc(c2)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4',7-Dimethoxyisoflavone is isolated from the leaves of Albizzia lebbeck, which shows antifungal activity. |
| In Vitro | 4',7-Dimethoxyisoflavone shows antifungal activity against some plant pathogenic fungi tested in vitro, and the sensitivity of different fungi to this chemical varied considerably[1]. |
| Density | 1.242g/cm3 |
| Boiling Point | 452.8ºC at 760mmHg |
| Flash Point | 202.2ºC |
| Exact Mass | 282.08900 |
| PSA | 48.67000 |
| LogP | 3.47720 |
| Vapour Pressure | 2.18E-08mmHg at 25°C |