Home
Products
Luteolinidin chloride
| Product Name | Luteolinidin chloride |
| Price: | $424 / 5mg |
| Catalog No.: | CN04400 |
| CAS No.: | 1154-78-5 |
| Molecular Formula: | C15H11ClO5 |
| Molecular Weight: | 306.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)[o+]c(cc2)c1ccc(c(c1)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Luteolinidin is a natural deoxyanthocyanidin, isolated from mosses and ferns[1]. Luteolinidin is a potent CD38 inhibitor which can protect the heart against I/R injury with preservation of eNOS function and prevention of endothelial dysfunction in vivo[2]. |
| Target | Ki: 11 μM (CD 38)[2] |
| Density | 1.530 g/mL at 25 °C(lit.) |
| Boiling Point | 229-230 °C(lit.) |
| Flash Point | >230 °F |
| Exact Mass | 306.03000 |
| PSA | 94.06000 |
| LogP | 0.20730 |