Home
Products
Tezacaftor (VX-661)
| Product Name | Tezacaftor (VX-661) |
| Price: | Inquiry |
| Catalog No.: | CN00301 |
| CAS No.: | 1152311-62-0 |
| Molecular Formula: | C26H27F3N2O6 |
| Molecular Weight: | 520.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H](Cn1c2cc(F)c(cc2cc1C(CO)(C)C)NC(=O)C1(CC1)c1ccc2c(c1)OC(O2)(F)F)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | VX-661 is a second F508del CFTR corrector and help CFTR protein reach the cell surface. |
| In Vitro | In vitro, a combination of VX-661 and ivacaftor results in greater CFTR activity compared with VX-661 alone[2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 610.8±55.0 °C at 760 mmHg |
| Flash Point | 323.2±31.5 °C |
| Exact Mass | 520.182129 |
| PSA | 113.18000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | -20℃ |