Home
Products
Apigeninidin chloride
| Product Name | Apigeninidin chloride |
| Price: | Inquiry |
| Catalog No.: | CN04405 |
| CAS No.: | 1151-98-0 |
| Molecular Formula: | C15H11ClO4 |
| Molecular Weight: | 290.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)c1ccc2c([o+]1)cc(cc2O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Apigeninidin (Gesneridin) chloride, a 3‐deoxyanthocyanidin, is a fungal growth inhibitor. Apigeninidin chloride is a bioactive red biocolorant[1]. |
| Exact Mass | 290.03500 |
| PSA | 73.83000 |
| LogP | 0.50170 |
| Storage condition | −20°C |