Home
Products
Linalyl acetate
| Product Name | Linalyl acetate |
| Price: | Inquiry |
| Catalog No.: | CN09613 |
| CAS No.: | 115-95-7 |
| Molecular Formula: | C12H20O2 |
| Molecular Weight: | 196.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The essential oil of Lavender |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CC(OC(=O)C)(CCC=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Linalyl acetate is the principal components of many plant essential oils with potentially anti-inflammatory activity[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 220.0±0.0 °C at 760 mmHg |
| Flash Point | 90.0±0.0 °C |
| Exact Mass | 196.146332 |
| PSA | 26.30000 |
| LogP | 3.83 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Storage condition | 2-8°C |