Home
Products
Soyasaponin Ba
| Product Name | Soyasaponin Ba |
| Price: | $467 / 10mg |
| Catalog No.: | CN07554 |
| CAS No.: | 114590-20-4 |
| Molecular Formula: | C48H78O19 |
| Molecular Weight: | 959.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@H]2O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Soyasaponin Ba is a soyasaponin isolated from Phaseolus vulgaris, acts as an aldose reductase inhibitors (ARI)[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1054.6±65.0 °C at 760 mmHg |
| Flash Point | 300.1±27.8 °C |
| Exact Mass | 958.513733 |
| PSA | 315.21000 |
| LogP | 5.85 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |