Home
Products
Oroxin B
| Product Name | Oroxin B |
| Price: | Inquiry |
| Catalog No.: | CN05508 |
| CAS No.: | 114482-86-9 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Scutellaria baicalensis. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(Oc3cc4oc(cc(=O)c4c(c3O)O)c3ccccc3)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oroxin B (OB) is a flavonoid isolated from traditional Chinese herbal medicine Oroxylum indicum (L.) Vent. Oroxin B (OB) possesses obvious inhibitory effect and induces early apoptosis rather than late apoptosis on liver cancer cells through upregulation of PTEN, down regulation of COX-2, VEGF, PI3K, and p-AKT[1].Oroxin B (OB) selectively induces tumor-suppressive ER stress in malignant lymphoma cells[2]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 957.5±65.0 °C at 760 mmHg |
| Flash Point | 318.1±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 249.20000 |
| LogP | -0.57 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20 °C |