Home
Products
Caryophyllene oxide
| Product Name | Caryophyllene oxide |
| Price: | $62 / 20mg |
| Catalog No.: | CN09543 |
| CAS No.: | 1139-30-6 |
| Molecular Formula: | C15H24O |
| Molecular Weight: | 220.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Eugenia caryophyllata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1CC[C@H]2O[C@@]2(CC[C@@H]2[C@@H]1CC2(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Caryophyllene oxide, isolated from from Annona squamosa L. bark., possesses analgesic and anti-inflammatory activity[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 279.7±19.0 °C at 760 mmHg |
| Flash Point | 119.7±19.5 °C |
| Exact Mass | 220.182709 |
| PSA | 12.53000 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |