Home
Products
Epimagnolin B
| Product Name | Epimagnolin B |
| Price: | $321 / 10mg |
| Catalog No.: | CN02676 |
| CAS No.: | 1134188-26-3 |
| Molecular Formula: | C23H28O7 |
| Molecular Weight: | 416.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The dried flower buds of Magnolia biondii Pamp. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(OC)cc(c1)[C@@H]1OC[C@H]2[C@@H]1CO[C@@H]2c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epimagnolin B is a bisepoxylignan isolated from Magnolia fargesii, with anti-inflammatory activity and antiallergic effects. Epimagnolin B inhibits NO production in LPS-activated microglia. Epimagnolin B exhibited antiallergic effects[1][2]. |
| In Vitro | Epimagnolin B exhibits antiallergic effects without affecting the viability of BMMCs[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 548.2±50.0 °C at 760 mmHg |
| Flash Point | 220.9±30.0 °C |
| Exact Mass | 416.183502 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8℃ |