Home
Products
7-O-Methylrosmanol
| Product Name | 7-O-Methylrosmanol |
| Price: | $219 / 10mg |
| Catalog No.: | CN08383 |
| CAS No.: | 113085-62-4 |
| Molecular Formula: | C21H28O5 |
| Molecular Weight: | 360.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rosmarinus officinalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CO[C@@H]1[C@H]2OC(=O)[C@]3([C@@H]2C(C)(C)CCC3)c2c1cc(C(C)C)c(c2O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Methoxyrosmanol (7-O-Methoxyrosmanol), a phenolic diterpene isolated from rosemary, suppresses the cAMP responsiveness of PEPCK and G6Pase promoters[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 542.3±50.0 °C at 760 mmHg |
| Flash Point | 189.7±23.6 °C |
| Exact Mass | 360.193665 |
| PSA | 75.99000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | ?20°C |