Home
Products
Letrozole
| Product Name | Letrozole |
| Price: | Inquiry |
| Catalog No.: | CN00303 |
| CAS No.: | 112809-51-5 |
| Molecular Formula: | C17H11N5 |
| Molecular Weight: | 285.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | N#Cc1ccc(cc1)C(n1cncn1)c1ccc(cc1)C#N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Letrozole is an aromatase inhibitor with an IC50 of 1-13 nM. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 472.0±55.0 °C at 760 mmHg |
| Flash Point | 214.2±24.5 °C |
| Exact Mass | 263.142242 |
| PSA | 78.29000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20°C Freezer |