Home
Products
Tubuloside A
| Product Name | Tubuloside A |
| Price: | $342 / 5mg |
| Catalog No.: | CN06870 |
| CAS No.: | 112516-05-9 |
| Molecular Formula: | C37H48O21 |
| Molecular Weight: | 828.764 |
| Purity: | ≥98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Cistanche tubulosa (Schenk) Wight |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(OCCc3ccc(c(c3)O)O)C(C(C2OC(=O)/C=C/c2ccc(c(c2)O)O)OC2OC(C)C(C(C2O)O)O)OC(=O)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tubuloside A is a phenylethanoid glycoside with antioxidative effect and hepatoprotective activity. |
| In Vitro | Tubuloside A is a phenylethanoid glycoside with antioxidative effect and hepatoprotective activity[1][2]. Tubuloside A (8.6 μM) could inhibit D-GalN-induced death of hepatocytes[2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1045.5±65.0 °C at 760 mmHg |
| Flash Point | 317.7±27.8 °C |
| Exact Mass | 828.268799 |
| PSA | 330.51000 |
| LogP | 0.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |