Home
Products
Tubuloside B
| Product Name | Tubuloside B |
| Price: | $351 / 10mg |
| Catalog No.: | CN06764 |
| CAS No.: | 112516-04-8 |
| Molecular Formula: | C31H38O16 |
| Molecular Weight: | 666.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Cistanche tubulosa (Schenk) Wight |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OC[C@H]1O[C@@H](OCCc2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)OC(=O)C)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tubuloside B, one of the phenylethanoids isolated from the stems of Cistanche salsa, inhibits TNFα-induced apoptosis. Tubuloside B possesses antioxidative effects[1][2]. |
| In Vitro | Pretreatment with tubuloside B (1, 10, or 100 mg/L) for 2 h attenuates the TNFα-mediated apoptosis[1]. |
| Exact Mass | 666.21600 |
| PSA | 251.36000 |