Home
Products
3'-Demethylnobiletin
| Product Name | 3'-Demethylnobiletin |
| Price: | $249 / 10mg |
| Catalog No.: | CN04511 |
| CAS No.: | 112448-39-2 |
| Molecular Formula: | C20H20O8 |
| Molecular Weight: | 388.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus nobilis Lour. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1O)c1cc(=O)c2c(o1)c(OC)c(c(c2OC)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3'-Demethylnobiletin, a derivative of Nobiletin, is a polymethoxyflavonoid in citrus fruits[1]. Nobiletin exhibits anticancer activity and inhibits tumor angiogenesis by regulating Src, FAK, and STAT3 signaling[2]. |
| Density | 1.304g/cm3 |
| Boiling Point | 613.8ºC at 760 mmHg |
| Flash Point | 218.8ºC |
| Exact Mass | 388.11600 |
| PSA | 96.59000 |
| LogP | 3.20860 |
| Vapour Pressure | 1.17E-15mmHg at 25°C |