Home
Products
Oleic acid
| Product Name | Oleic acid |
| Price: | $15 / 20mg |
| Catalog No.: | CN06522 |
| CAS No.: | 112-80-1 |
| Molecular Formula: | C18H34O2 |
| Molecular Weight: | 282.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The whole plants of Citrullus colocynthis (Linn.) Schrad. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCC/C=CCCCCCCCC(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oleic acid is an abundant monounsaturated fatty acid. |
| Target | Human Endogenous Metabolite |
| In Vitro | Oleic acid is the most common monounsaturated fatty acids (FA) in human adipocytes and other tissues. Oleic acid prompts cell proliferation and migration in high metastatic cancer cells via enhancing β-oxidation mediated by AMPK activation. Oleic acid inhibits cancer cell growth and survival in low metastatic carcinoma cells, such as gastric carcinoma SGC7901 and breast carcinoma MCF-7 cell lines[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 360.0±0.0 °C at 760 mmHg |
| Flash Point | 270.1±14.4 °C |
| Exact Mass | 282.255890 |
| PSA | 37.30000 |
| LogP | 7.70 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8°C |