Home
Products
Methyl linoleate
| Product Name | Methyl linoleate |
| Price: | $23 / 20mg |
| Catalog No.: | CN06508 |
| CAS No.: | 112-63-0 |
| Molecular Formula: | C19H34O2 |
| Molecular Weight: | 294.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | Constit. of most vegetable oils and animal fats |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCC/C=CC/C=CCCCCCCCC(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methyl linoleate, a major active constituent of Sageretia thea fruit (HFSF), is a major anti-melanogenic compound. Methyl linoleate downregulates microphthalmia-associated transcription factor (MITF) and tyrosinase-related proteins[1]. |
| In Vitro | Sageretia thea fruit extracts rich in Methyl linoleate downregulate melanogenesis via the Akt/GSK3β signaling pathway. The HFSF and Methyl linoleate inhibit β-catenin-mediated transcriptional activation of MITF through the Akt/GSK3β signaling pathway[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 373.3±21.0 °C at 760 mmHg |
| Flash Point | 96.9±20.4 °C |
| Exact Mass | 294.255890 |
| PSA | 26.30000 |
| LogP | 7.64 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8°C |