Home
Products
Methyl oleate
| Product Name | Methyl oleate |
| Price: | $9 / 50mg |
| Catalog No.: | CN06459 |
| CAS No.: | 112-62-9 |
| Molecular Formula: | C19H36O2 |
| Molecular Weight: | 296.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCC/C=CCCCCCCCC(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Methyl oleate is a fatty acid methyl ester (FAME). Methyl oleate substantially improves the antioxidation ability but markedly impaired the antiwear capacity of zinc dialkyldithiophosphate (ZDDP)[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 351.4±0.0 °C at 760 mmHg |
| Flash Point | 92.4±20.4 °C |
| Exact Mass | 296.271515 |
| PSA | 26.30000 |
| LogP | 8.16 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Storage condition | −20°C |