Home
Products
Cyanidin-3-O-arabinoside chloride
| Product Name | Cyanidin-3-O-arabinoside chloride |
| Price: | Inquiry |
| Catalog No.: | CN05130 |
| CAS No.: | 111613-04-8 |
| Molecular Formula: | C20H19ClO10 |
| Molecular Weight: | 454.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O)c2c(c1)[o+]c(c(c2)O[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)c1ccc(c(c1)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyanidin-3-O-arabinoside is a pigment isolated from flowers of Rhododendron cv. Lems Stormcloud[1]. |
| Exact Mass | 454.06700 |
| PSA | 173.21000 |
| LogP | 1.82310 |
| Storage condition | -20C |